C20H33NO5 — CID 70068193
(Z)-but-2-enedioic acid;6-(dipropylamino)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one (PubChem CID 70068193) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;6-(dipropylamino)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one.
| Compound Name | (Z)-but-2-enedioic acid;6-(dipropylamino)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 70068193 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | (Z)-but-2-enedioic acid;6-(dipropylamino)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one |
| SMILES | CCCN(CCC)C1CCC2C(=O)CCCC2C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C16H29NO.C4H4O4/c1-3-10-17(11-4-2)14-8-9-15-13(12-14)6-5-7-16(15)18;5-3(6)1-2-4(7)8/h13-15H,3-12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | GIFGHUQHDXMESC-BTJKTKAUSA-N |
| XLogP | 3.36 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|