C16H30ClNO — CID 70068540
6-(dipropylamino)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one;hydrochloride (PubChem CID 70068540) has the molecular formula C16H30ClNO and a molecular weight of 287.87 g/mol. Its IUPAC name is 6-(dipropylamino)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one;hydrochloride.
| Compound Name | 6-(dipropylamino)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one;hydrochloride |
|---|---|
| PubChem CID | 70068540 |
| Molecular Formula | C16H30ClNO |
| Molecular Weight | 287.87 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 6-(dipropylamino)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one;hydrochloride |
| SMILES | CCCN(CCC)C1CCC2C(=O)CCCC2C1.Cl |
| InChI | InChI=1S/C16H29NO.ClH/c1-3-10-17(11-4-2)14-8-9-15-13(12-14)6-5-7-16(15)18;/h13-15H,3-12H2,1-2H3;1H |
| InChIKey | DXMLEZFOVPWFBO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.87 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |