About 4-[4-[(2S)-3,3-diethyl-4-oxoazetidin-2-yl]oxyphenyl]-4-oxobutanenitrile
4-[4-[(2S)-3,3-diethyl-4-oxoazetidin-2-yl]oxyphenyl]-4-oxobutanenitrile (PubChem CID 70068695) has the molecular formula C17H20N2O3
and a molecular weight of 300.36 g/mol. Its IUPAC name is 4-[4-[(2S)-3,3-diethyl-4-oxoazetidin-2-yl]oxyphenyl]-4-oxobutanenitrile.
Molecular Properties
| Compound Name | 4-[4-[(2S)-3,3-diethyl-4-oxoazetidin-2-yl]oxyphenyl]-4-oxobutanenitrile |
| PubChem CID | 70068695 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 4-[4-[(2S)-3,3-diethyl-4-oxoazetidin-2-yl]oxyphenyl]-4-oxobutanenitrile |
| SMILES | CCC1(CC)C(=O)N[C@H]1Oc1ccc(C(=O)CCC#N)cc1 |
| InChI | InChI=1S/C17H20N2O3/c1-3-17(4-2)15(21)19-16(17)22-13-9-7-12(8-10-13)14(20)6-5-11-18/h7-10,16H,3-6H2,1-2H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | RRKFPXCFDJOIQT-INIZCTEOSA-N |
| XLogP | 2.81 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-[(2S)-3,3-diethyl-4-oxoazetidin-2-yl]oxyphenyl]-4-oxobutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(2S)-3,3-diethyl-4-oxoazetidin-2-yl]oxyphenyl]-4-oxobutanenitrile?
The IUPAC name of 4-[4-[(2S)-3,3-diethyl-4-oxoazetidin-2-yl]oxyphenyl]-4-oxobutanenitrile (CID 70068695) is 4-[4-[(2S)-3,3-diethyl-4-oxoazetidin-2-yl]oxyphenyl]-4-oxobutanenitrile.
What is the SMILES notation for 4-[4-[(2S)-3,3-diethyl-4-oxoazetidin-2-yl]oxyphenyl]-4-oxobutanenitrile?
The canonical SMILES for 4-[4-[(2S)-3,3-diethyl-4-oxoazetidin-2-yl]oxyphenyl]-4-oxobutanenitrile is CCC1(CC)C(=O)N[C@H]1Oc1ccc(C(=O)CCC#N)cc1.
What is the InChIKey of 4-[4-[(2S)-3,3-diethyl-4-oxoazetidin-2-yl]oxyphenyl]-4-oxobutanenitrile?
The InChIKey is RRKFPXCFDJOIQT-INIZCTEOSA-N. The full InChI is InChI=1S/C17H20N2O3/c1-3-17(4-2)15(21)19-16(17)22-13-9-7-12(8-10-13)14(20)6-5-11-18/h7-10,16H,3-6H2,1-2H3,(H,19,21)/t16-/m0/s1.
What are the key properties of 4-[4-[(2S)-3,3-diethyl-4-oxoazetidin-2-yl]oxyphenyl]-4-oxobutanenitrile?
4-[4-[(2S)-3,3-diethyl-4-oxoazetidin-2-yl]oxyphenyl]-4-oxobutanenitrile has a molecular weight of 300.36 g/mol, XLogP of 2.81, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2S)-3,3-diethyl-4-oxoazetidin-2-yl]oxyphenyl]-4-oxobutanenitrile is sourced from PubChem (CID 70068695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).