C14H23NO2 — CID 70068839
7-acetyl-1-propyl-2,3,4,4a,5,6,7,8a-octahydroquinolin-8-one (PubChem CID 70068839) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 7-acetyl-1-propyl-2,3,4,4a,5,6,7,8a-octahydroquinolin-8-one.
| Compound Name | 7-acetyl-1-propyl-2,3,4,4a,5,6,7,8a-octahydroquinolin-8-one |
|---|---|
| PubChem CID | 70068839 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 7-acetyl-1-propyl-2,3,4,4a,5,6,7,8a-octahydroquinolin-8-one |
| SMILES | CCCN1CCCC2CCC(C(C)=O)C(=O)C21 |
| InChI | InChI=1S/C14H23NO2/c1-3-8-15-9-4-5-11-6-7-12(10(2)16)14(17)13(11)15/h11-13H,3-9H2,1-2H3 |
| InChIKey | OVYGBRMTJMBDQI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|