C8H10OS — CID 70069088
3,3a,5,6-tetrahydro-1H-2-benzothiophen-4-one (PubChem CID 70069088) has the molecular formula C8H10OS and a molecular weight of 154.23 g/mol. Its IUPAC name is 3,3a,5,6-tetrahydro-1H-2-benzothiophen-4-one.
| Compound Name | 3,3a,5,6-tetrahydro-1H-2-benzothiophen-4-one |
|---|---|
| PubChem CID | 70069088 |
| Molecular Formula | C8H10OS |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 3,3a,5,6-tetrahydro-1H-2-benzothiophen-4-one |
| SMILES | O=C1CCC=C2CSCC12 |
| InChI | InChI=1S/C8H10OS/c9-8-3-1-2-6-4-10-5-7(6)8/h2,7H,1,3-5H2 |
| InChIKey | SNJZDWHYUJGNOC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|