About 4-amino-5-cyclohexyl-2,5-difluoro-3-hydroxy-N-methylpentanamide
4-amino-5-cyclohexyl-2,5-difluoro-3-hydroxy-N-methylpentanamide (PubChem CID 70069228) has the molecular formula C12H22F2N2O2
and a molecular weight of 264.32 g/mol. Its IUPAC name is 4-amino-5-cyclohexyl-2,5-difluoro-3-hydroxy-N-methylpentanamide.
Molecular Properties
| Compound Name | 4-amino-5-cyclohexyl-2,5-difluoro-3-hydroxy-N-methylpentanamide |
| PubChem CID | 70069228 |
| Molecular Formula | C12H22F2N2O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 4-amino-5-cyclohexyl-2,5-difluoro-3-hydroxy-N-methylpentanamide |
| SMILES | CNC(=O)C(F)C(O)C(N)C(F)C1CCCCC1 |
| InChI | InChI=1S/C12H22F2N2O2/c1-16-12(18)9(14)11(17)10(15)8(13)7-5-3-2-4-6-7/h7-11,17H,2-6,15H2,1H3,(H,16,18) |
| InChIKey | KDTCSNPGTWKPLJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-5-cyclohexyl-2,5-difluoro-3-hydroxy-N-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-cyclohexyl-2,5-difluoro-3-hydroxy-N-methylpentanamide?
The IUPAC name of 4-amino-5-cyclohexyl-2,5-difluoro-3-hydroxy-N-methylpentanamide (CID 70069228) is 4-amino-5-cyclohexyl-2,5-difluoro-3-hydroxy-N-methylpentanamide.
What is the SMILES notation for 4-amino-5-cyclohexyl-2,5-difluoro-3-hydroxy-N-methylpentanamide?
The canonical SMILES for 4-amino-5-cyclohexyl-2,5-difluoro-3-hydroxy-N-methylpentanamide is CNC(=O)C(F)C(O)C(N)C(F)C1CCCCC1.
What is the InChIKey of 4-amino-5-cyclohexyl-2,5-difluoro-3-hydroxy-N-methylpentanamide?
The InChIKey is KDTCSNPGTWKPLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F2N2O2/c1-16-12(18)9(14)11(17)10(15)8(13)7-5-3-2-4-6-7/h7-11,17H,2-6,15H2,1H3,(H,16,18).
What are the key properties of 4-amino-5-cyclohexyl-2,5-difluoro-3-hydroxy-N-methylpentanamide?
4-amino-5-cyclohexyl-2,5-difluoro-3-hydroxy-N-methylpentanamide has a molecular weight of 264.32 g/mol, XLogP of 0.68, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-cyclohexyl-2,5-difluoro-3-hydroxy-N-methylpentanamide is sourced from PubChem (CID 70069228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).