3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid

C12H10FNO4 — CID 70070460

IUPAC3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid
SMILESO=C(O)CCc1c(-c2ccc(F)cc2)o[nH]c1=O
InChIInChI=1S/C12H10FNO4/c13-8-3-1-7(2-4-8)11-9(5-6-10(15)16)12(17)14-18-11/h1-4H,5-6H2,(H,14,17)(H,15,16)
InChIKeyMIUAMBWQRWLNTE-UHFFFAOYSA-N
MW251.21 g/mol
LogP1.79
Rot. Bonds4

About 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid

3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid (PubChem CID 70070460) has the molecular formula C12H10FNO4 and a molecular weight of 251.21 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid.

Molecular Properties

Compound Name3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid
PubChem CID70070460
Molecular FormulaC12H10FNO4
Molecular Weight251.21 g/mol
Exact Mass251.06
IUPAC Name3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid
SMILESO=C(O)CCc1c(-c2ccc(F)cc2)o[nH]c1=O
InChIInChI=1S/C12H10FNO4/c13-8-3-1-7(2-4-8)11-9(5-6-10(15)16)12(17)14-18-11/h1-4H,5-6H2,(H,14,17)(H,15,16)
InChIKeyMIUAMBWQRWLNTE-UHFFFAOYSA-N
XLogP1.79
TPSA83.30 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.21
LogP ≤ 51.79
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid?
The IUPAC name of 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid (CID 70070460) is 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid.
What is the SMILES notation for 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid?
The canonical SMILES for 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid is O=C(O)CCc1c(-c2ccc(F)cc2)o[nH]c1=O.
What is the InChIKey of 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid?
The InChIKey is MIUAMBWQRWLNTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FNO4/c13-8-3-1-7(2-4-8)11-9(5-6-10(15)16)12(17)14-18-11/h1-4H,5-6H2,(H,14,17)(H,15,16).
What are the key properties of 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid?
3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid has a molecular weight of 251.21 g/mol, XLogP of 1.79, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid is sourced from PubChem (CID 70070460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).