About 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid
3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid (PubChem CID 70070460) has the molecular formula C12H10FNO4
and a molecular weight of 251.21 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid |
| PubChem CID | 70070460 |
| Molecular Formula | C12H10FNO4 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1c(-c2ccc(F)cc2)o[nH]c1=O |
| InChI | InChI=1S/C12H10FNO4/c13-8-3-1-7(2-4-8)11-9(5-6-10(15)16)12(17)14-18-11/h1-4H,5-6H2,(H,14,17)(H,15,16) |
| InChIKey | MIUAMBWQRWLNTE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid?
The IUPAC name of 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid (CID 70070460) is 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid.
What is the SMILES notation for 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid?
The canonical SMILES for 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid is O=C(O)CCc1c(-c2ccc(F)cc2)o[nH]c1=O.
What is the InChIKey of 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid?
The InChIKey is MIUAMBWQRWLNTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FNO4/c13-8-3-1-7(2-4-8)11-9(5-6-10(15)16)12(17)14-18-11/h1-4H,5-6H2,(H,14,17)(H,15,16).
What are the key properties of 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid?
3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid has a molecular weight of 251.21 g/mol, XLogP of 1.79, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid is sourced from PubChem (CID 70070460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).