C18H17N3O2 — CID 70070501
4-[[3-(1,3-benzoxazol-2-yl)phenyl]methyl]piperazin-2-one (PubChem CID 70070501) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-[[3-(1,3-benzoxazol-2-yl)phenyl]methyl]piperazin-2-one.
| Compound Name | 4-[[3-(1,3-benzoxazol-2-yl)phenyl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 70070501 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 4-[[3-(1,3-benzoxazol-2-yl)phenyl]methyl]piperazin-2-one |
| SMILES | O=C1CN(Cc2cccc(-c3nc4ccccc4o3)c2)CCN1 |
| InChI | InChI=1S/C18H17N3O2/c22-17-12-21(9-8-19-17)11-13-4-3-5-14(10-13)18-20-15-6-1-2-7-16(15)23-18/h1-7,10H,8-9,11-12H2,(H,19,22) |
| InChIKey | OXQBBJWLBIKEEG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |