C24H30O4 — CID 70070826
(4R)-2-[(3-methylphenyl)methyl]-4-[2-(4-propylphenyl)ethyl]pentanedioic acid (PubChem CID 70070826) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is (4R)-2-[(3-methylphenyl)methyl]-4-[2-(4-propylphenyl)ethyl]pentanedioic acid.
| Compound Name | (4R)-2-[(3-methylphenyl)methyl]-4-[2-(4-propylphenyl)ethyl]pentanedioic acid |
|---|---|
| PubChem CID | 70070826 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (4R)-2-[(3-methylphenyl)methyl]-4-[2-(4-propylphenyl)ethyl]pentanedioic acid |
| SMILES | CCCc1ccc(CC[C@H](CC(Cc2cccc(C)c2)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C24H30O4/c1-3-5-18-8-10-19(11-9-18)12-13-21(23(25)26)16-22(24(27)28)15-20-7-4-6-17(2)14-20/h4,6-11,14,21-22H,3,5,12-13,15-16H2,1-2H3,(H,25,26)(H,27,28)/t21-,22?/m1/s1 |
| InChIKey | AYCRNSGJVHQBHJ-ZMFCMNQTSA-N |
| XLogP | 4.91 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |