C18H24BrNO4S — CID 70070933
(6R)-4-bromo-2-(2,2-dimethylpropanoyl)-3-methyl-5,5-dioxo-7,7-bis(prop-2-enyl)-5λ6-thia-1-azabicyclo[4.2.0]oct-2-en-8-one (PubChem CID 70070933) has the molecular formula C18H24BrNO4S and a molecular weight of 430.36 g/mol. Its IUPAC name is (6R)-4-bromo-2-(2,2-dimethylpropanoyl)-3-methyl-5,5-dioxo-7,7-bis(prop-2-enyl)-5λ6-thia-1-azabicyclo[4.2.0]oct-2-en-8-one.
| Compound Name | (6R)-4-bromo-2-(2,2-dimethylpropanoyl)-3-methyl-5,5-dioxo-7,7-bis(prop-2-enyl)-5λ6-thia-1-azabicyclo[4.2.0]oct-2-en-8-one |
|---|---|
| PubChem CID | 70070933 |
| Molecular Formula | C18H24BrNO4S |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | (6R)-4-bromo-2-(2,2-dimethylpropanoyl)-3-methyl-5,5-dioxo-7,7-bis(prop-2-enyl)-5λ6-thia-1-azabicyclo[4.2.0]oct-2-en-8-one |
| SMILES | C=CCC1(CC=C)C(=O)N2C(C(=O)C(C)(C)C)=C(C)C(Br)S(=O)(=O)[C@@H]21 |
| InChI | InChI=1S/C18H24BrNO4S/c1-7-9-18(10-8-2)15(22)20-12(13(21)17(4,5)6)11(3)14(19)25(23,24)16(18)20/h7-8,14,16H,1-2,9-10H2,3-6H3/t14?,16-/m1/s1 |
| InChIKey | QDXUEAYDLXHJAX-BZSJEYESSA-N |
| XLogP | 3.33 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|