About (4S)-5-(hydroxyamino)-4-[2-(hydroxyamino)prop-1-enyl]-7H-2,1,3-benzoxadiazol-4-ol
(4S)-5-(hydroxyamino)-4-[2-(hydroxyamino)prop-1-enyl]-7H-2,1,3-benzoxadiazol-4-ol (PubChem CID 7007139) has the molecular formula C9H12N4O4
and a molecular weight of 240.22 g/mol. Its IUPAC name is (4S)-5-(hydroxyamino)-4-[2-(hydroxyamino)prop-1-enyl]-7H-2,1,3-benzoxadiazol-4-ol.
Molecular Properties
| Compound Name | (4S)-5-(hydroxyamino)-4-[2-(hydroxyamino)prop-1-enyl]-7H-2,1,3-benzoxadiazol-4-ol |
| PubChem CID | 7007139 |
| Molecular Formula | C9H12N4O4 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (4S)-5-(hydroxyamino)-4-[2-(hydroxyamino)prop-1-enyl]-7H-2,1,3-benzoxadiazol-4-ol |
| SMILES | CC(=C[C@]1(O)C(NO)=CCc2nonc21)NO |
| InChI | InChI=1S/C9H12N4O4/c1-5(10-15)4-9(14)7(11-16)3-2-6-8(9)13-17-12-6/h3-4,10-11,14-16H,2H2,1H3/t9-/m0/s1 |
| InChIKey | IMGVPHURKUZBAO-VIFPVBQESA-N |
| XLogP | -0.44 |
| TPSA | 123.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S)-5-(hydroxyamino)-4-[2-(hydroxyamino)prop-1-enyl]-7H-2,1,3-benzoxadiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-5-(hydroxyamino)-4-[2-(hydroxyamino)prop-1-enyl]-7H-2,1,3-benzoxadiazol-4-ol?
The IUPAC name of (4S)-5-(hydroxyamino)-4-[2-(hydroxyamino)prop-1-enyl]-7H-2,1,3-benzoxadiazol-4-ol (CID 7007139) is (4S)-5-(hydroxyamino)-4-[2-(hydroxyamino)prop-1-enyl]-7H-2,1,3-benzoxadiazol-4-ol.
What is the SMILES notation for (4S)-5-(hydroxyamino)-4-[2-(hydroxyamino)prop-1-enyl]-7H-2,1,3-benzoxadiazol-4-ol?
The canonical SMILES for (4S)-5-(hydroxyamino)-4-[2-(hydroxyamino)prop-1-enyl]-7H-2,1,3-benzoxadiazol-4-ol is CC(=C[C@]1(O)C(NO)=CCc2nonc21)NO.
What is the InChIKey of (4S)-5-(hydroxyamino)-4-[2-(hydroxyamino)prop-1-enyl]-7H-2,1,3-benzoxadiazol-4-ol?
The InChIKey is IMGVPHURKUZBAO-VIFPVBQESA-N. The full InChI is InChI=1S/C9H12N4O4/c1-5(10-15)4-9(14)7(11-16)3-2-6-8(9)13-17-12-6/h3-4,10-11,14-16H,2H2,1H3/t9-/m0/s1.
What are the key properties of (4S)-5-(hydroxyamino)-4-[2-(hydroxyamino)prop-1-enyl]-7H-2,1,3-benzoxadiazol-4-ol?
(4S)-5-(hydroxyamino)-4-[2-(hydroxyamino)prop-1-enyl]-7H-2,1,3-benzoxadiazol-4-ol has a molecular weight of 240.22 g/mol, XLogP of -0.44, 3 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-5-(hydroxyamino)-4-[2-(hydroxyamino)prop-1-enyl]-7H-2,1,3-benzoxadiazol-4-ol is sourced from PubChem (CID 7007139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).