About 5-ethyl-6-hydroxy-1,6-naphthyridin-2-one;hydrate
5-ethyl-6-hydroxy-1,6-naphthyridin-2-one;hydrate (PubChem CID 70072036) has the molecular formula C10H12N2O3
and a molecular weight of 208.22 g/mol. Its IUPAC name is 5-ethyl-6-hydroxy-1,6-naphthyridin-2-one;hydrate.
Molecular Properties
| Compound Name | 5-ethyl-6-hydroxy-1,6-naphthyridin-2-one;hydrate |
| PubChem CID | 70072036 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 5-ethyl-6-hydroxy-1,6-naphthyridin-2-one;hydrate |
| SMILES | CCc1c2ccc(=O)nc-2ccn1O.O |
| InChI | InChI=1S/C10H10N2O2.H2O/c1-2-9-7-3-4-10(13)11-8(7)5-6-12(9)14;/h3-6,14H,2H2,1H3;1H2 |
| InChIKey | HFGPQJRRJXRHTM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-6-hydroxy-1,6-naphthyridin-2-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-6-hydroxy-1,6-naphthyridin-2-one;hydrate?
The IUPAC name of 5-ethyl-6-hydroxy-1,6-naphthyridin-2-one;hydrate (CID 70072036) is 5-ethyl-6-hydroxy-1,6-naphthyridin-2-one;hydrate.
What is the SMILES notation for 5-ethyl-6-hydroxy-1,6-naphthyridin-2-one;hydrate?
The canonical SMILES for 5-ethyl-6-hydroxy-1,6-naphthyridin-2-one;hydrate is CCc1c2ccc(=O)nc-2ccn1O.O.
What is the InChIKey of 5-ethyl-6-hydroxy-1,6-naphthyridin-2-one;hydrate?
The InChIKey is HFGPQJRRJXRHTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2.H2O/c1-2-9-7-3-4-10(13)11-8(7)5-6-12(9)14;/h3-6,14H,2H2,1H3;1H2.
What are the key properties of 5-ethyl-6-hydroxy-1,6-naphthyridin-2-one;hydrate?
5-ethyl-6-hydroxy-1,6-naphthyridin-2-one;hydrate has a molecular weight of 208.22 g/mol, XLogP of 0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-6-hydroxy-1,6-naphthyridin-2-one;hydrate is sourced from PubChem (CID 70072036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).