C21H28ClN3O3 — CID 70072156
(2S)-1-[[2-(aminomethyl)-5-chlorophenyl]methyl]-N-(2-hydroxy-2,5-dimethylhex-3-ynoyl)pyrrolidine-2-carboxamide (PubChem CID 70072156) has the molecular formula C21H28ClN3O3 and a molecular weight of 405.93 g/mol. Its IUPAC name is (2S)-1-[[2-(aminomethyl)-5-chlorophenyl]methyl]-N-(2-hydroxy-2,5-dimethylhex-3-ynoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[[2-(aminomethyl)-5-chlorophenyl]methyl]-N-(2-hydroxy-2,5-dimethylhex-3-ynoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70072156 |
| Molecular Formula | C21H28ClN3O3 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (2S)-1-[[2-(aminomethyl)-5-chlorophenyl]methyl]-N-(2-hydroxy-2,5-dimethylhex-3-ynoyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)C#CC(C)(O)C(=O)NC(=O)[C@@H]1CCCN1Cc1cc(Cl)ccc1CN |
| InChI | InChI=1S/C21H28ClN3O3/c1-14(2)8-9-21(3,28)20(27)24-19(26)18-5-4-10-25(18)13-16-11-17(22)7-6-15(16)12-23/h6-7,11,14,18,28H,4-5,10,12-13,23H2,1-3H3,(H,24,26,27)/t18-,21?/m0/s1 |
| InChIKey | AENPRQUVKHGLEE-YMXDCFFPSA-N |
| XLogP | 1.82 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|