About 1-benzyl-3-(1,3-thiazol-2-yl)thiourea
1-benzyl-3-(1,3-thiazol-2-yl)thiourea (PubChem CID 700723) has the molecular formula C11H11N3S2
and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-benzyl-3-(1,3-thiazol-2-yl)thiourea.
Molecular Properties
| Compound Name | 1-benzyl-3-(1,3-thiazol-2-yl)thiourea |
| PubChem CID | 700723 |
| Molecular Formula | C11H11N3S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 1-benzyl-3-(1,3-thiazol-2-yl)thiourea |
| SMILES | S=C(NCc1ccccc1)Nc1nccs1 |
| InChI | InChI=1S/C11H11N3S2/c15-10(14-11-12-6-7-16-11)13-8-9-4-2-1-3-5-9/h1-7H,8H2,(H2,12,13,14,15) |
| InChIKey | PDHMEDMWKUZUAB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-3-(1,3-thiazol-2-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-(1,3-thiazol-2-yl)thiourea?
The IUPAC name of 1-benzyl-3-(1,3-thiazol-2-yl)thiourea (CID 700723) is 1-benzyl-3-(1,3-thiazol-2-yl)thiourea.
What is the SMILES notation for 1-benzyl-3-(1,3-thiazol-2-yl)thiourea?
The canonical SMILES for 1-benzyl-3-(1,3-thiazol-2-yl)thiourea is S=C(NCc1ccccc1)Nc1nccs1.
What is the InChIKey of 1-benzyl-3-(1,3-thiazol-2-yl)thiourea?
The InChIKey is PDHMEDMWKUZUAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3S2/c15-10(14-11-12-6-7-16-11)13-8-9-4-2-1-3-5-9/h1-7H,8H2,(H2,12,13,14,15).
What are the key properties of 1-benzyl-3-(1,3-thiazol-2-yl)thiourea?
1-benzyl-3-(1,3-thiazol-2-yl)thiourea has a molecular weight of 249.36 g/mol, XLogP of 2.63, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-(1,3-thiazol-2-yl)thiourea is sourced from PubChem (CID 700723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).