C28H45N3O — CID 70072930
3-[(3-aminocyclohexyl)methyl]-1-[5-(2,6-dimethylpiperidin-1-yl)pentyl]-3,4-dihydroquinolin-2-one (PubChem CID 70072930) has the molecular formula C28H45N3O and a molecular weight of 439.69 g/mol. Its IUPAC name is 3-[(3-aminocyclohexyl)methyl]-1-[5-(2,6-dimethylpiperidin-1-yl)pentyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 3-[(3-aminocyclohexyl)methyl]-1-[5-(2,6-dimethylpiperidin-1-yl)pentyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 70072930 |
| Molecular Formula | C28H45N3O |
| Molecular Weight | 439.69 g/mol |
| Exact Mass | 439.36 |
| IUPAC Name | 3-[(3-aminocyclohexyl)methyl]-1-[5-(2,6-dimethylpiperidin-1-yl)pentyl]-3,4-dihydroquinolin-2-one |
| SMILES | CC1CCCC(C)N1CCCCCN1C(=O)C(CC2CCCC(N)C2)Cc2ccccc21 |
| InChI | InChI=1S/C28H45N3O/c1-21-10-8-11-22(2)30(21)16-6-3-7-17-31-27-15-5-4-13-24(27)20-25(28(31)32)18-23-12-9-14-26(29)19-23/h4-5,13,15,21-23,25-26H,3,6-12,14,16-20,29H2,1-2H3 |
| InChIKey | XNFPBRIMAMYQGF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.69 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|