C23H35N4O6P — CID 70073594
(4-amino-1,3-dioxoisoindol-2-yl)methyl-[(2S)-4-methyl-2-[[(3S)-3-methyl-5-(methylamino)-5-oxopentyl]carbamoyl]pentyl]phosphinic acid (PubChem CID 70073594) has the molecular formula C23H35N4O6P and a molecular weight of 494.53 g/mol. Its IUPAC name is (4-amino-1,3-dioxoisoindol-2-yl)methyl-[(2S)-4-methyl-2-[[(3S)-3-methyl-5-(methylamino)-5-oxopentyl]carbamoyl]pentyl]phosphinic acid.
| Compound Name | (4-amino-1,3-dioxoisoindol-2-yl)methyl-[(2S)-4-methyl-2-[[(3S)-3-methyl-5-(methylamino)-5-oxopentyl]carbamoyl]pentyl]phosphinic acid |
|---|---|
| PubChem CID | 70073594 |
| Molecular Formula | C23H35N4O6P |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | (4-amino-1,3-dioxoisoindol-2-yl)methyl-[(2S)-4-methyl-2-[[(3S)-3-methyl-5-(methylamino)-5-oxopentyl]carbamoyl]pentyl]phosphinic acid |
| SMILES | CNC(=O)C[C@@H](C)CCNC(=O)[C@H](CC(C)C)CP(=O)(O)CN1C(=O)c2cccc(N)c2C1=O |
| InChI | InChI=1S/C23H35N4O6P/c1-14(2)10-16(21(29)26-9-8-15(3)11-19(28)25-4)12-34(32,33)13-27-22(30)17-6-5-7-18(24)20(17)23(27)31/h5-7,14-16H,8-13,24H2,1-4H3,(H,25,28)(H,26,29)(H,32,33)/t15-,16+/m0/s1 |
| InChIKey | PSISCBXBPZIIRQ-JKSUJKDBSA-N |
| XLogP | 2.03 |
| TPSA | 158.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|