C16H28NO3+ — CID 7007362
[(1R,2R,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl 2-morpholin-4-ium-4-ylacetate (PubChem CID 7007362) has the molecular formula C16H28NO3+ and a molecular weight of 282.40 g/mol. Its IUPAC name is [(1R,2R,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl 2-morpholin-4-ium-4-ylacetate.
| Compound Name | [(1R,2R,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl 2-morpholin-4-ium-4-ylacetate |
|---|---|
| PubChem CID | 7007362 |
| Molecular Formula | C16H28NO3+ |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | [(1R,2R,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl 2-morpholin-4-ium-4-ylacetate |
| SMILES | CC1=C[C@@H](C)[C@H](COC(=O)C[NH+]2CCOCC2)[C@@H](C)C1 |
| InChI | InChI=1S/C16H27NO3/c1-12-8-13(2)15(14(3)9-12)11-20-16(18)10-17-4-6-19-7-5-17/h8,13-15H,4-7,9-11H2,1-3H3/p+1/t13-,14+,15+/m1/s1 |
| InChIKey | HMLFTWYOAWGKNR-ILXRZTDVSA-O |
| XLogP | 0.68 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|