C27H29N3O5S2 — CID 70073724
N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]phenyl]-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 70073724) has the molecular formula C27H29N3O5S2 and a molecular weight of 539.68 g/mol. Its IUPAC name is N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]phenyl]-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]phenyl]-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 70073724 |
| Molecular Formula | C27H29N3O5S2 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]phenyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | CCCC(c1cccc(NS(=O)(=O)c2cccc3nsnc23)c1)c1c(O)c2c(oc1=O)CCCCCC2 |
| InChI | InChI=1S/C27H29N3O5S2/c1-2-9-19(24-26(31)20-12-5-3-4-6-14-22(20)35-27(24)32)17-10-7-11-18(16-17)30-37(33,34)23-15-8-13-21-25(23)29-36-28-21/h7-8,10-11,13,15-16,19,30-31H,2-6,9,12,14H2,1H3 |
| InChIKey | BGUYXQWDVHJXPG-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|