C18H29NO4S — CID 70073734
ethyl (2S)-2-[(1-tert-butylsulfonyl-3-phenylpropan-2-yl)amino]propanoate (PubChem CID 70073734) has the molecular formula C18H29NO4S and a molecular weight of 355.50 g/mol. Its IUPAC name is ethyl (2S)-2-[(1-tert-butylsulfonyl-3-phenylpropan-2-yl)amino]propanoate.
| Compound Name | ethyl (2S)-2-[(1-tert-butylsulfonyl-3-phenylpropan-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 70073734 |
| Molecular Formula | C18H29NO4S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | ethyl (2S)-2-[(1-tert-butylsulfonyl-3-phenylpropan-2-yl)amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NC(Cc1ccccc1)CS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C18H29NO4S/c1-6-23-17(20)14(2)19-16(12-15-10-8-7-9-11-15)13-24(21,22)18(3,4)5/h7-11,14,16,19H,6,12-13H2,1-5H3/t14-,16?/m0/s1 |
| InChIKey | ABHFFPHOHIZVPW-LBAUFKAWSA-N |
| XLogP | 2.35 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |