About 2-methyl-3H-1,2-thiazole 1-oxide;hydrochloride
2-methyl-3H-1,2-thiazole 1-oxide;hydrochloride (PubChem CID 70074222) has the molecular formula C4H8ClNOS
and a molecular weight of 153.63 g/mol. Its IUPAC name is 2-methyl-3H-1,2-thiazole 1-oxide;hydrochloride.
Molecular Properties
| Compound Name | 2-methyl-3H-1,2-thiazole 1-oxide;hydrochloride |
| PubChem CID | 70074222 |
| Molecular Formula | C4H8ClNOS |
| Molecular Weight | 153.63 g/mol |
| Exact Mass | 153.00 |
| IUPAC Name | 2-methyl-3H-1,2-thiazole 1-oxide;hydrochloride |
| SMILES | CN1CC=CS1=O.Cl |
| InChI | InChI=1S/C4H7NOS.ClH/c1-5-3-2-4-7(5)6;/h2,4H,3H2,1H3;1H |
| InChIKey | SADPNGVGIFQCOA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.63 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-3H-1,2-thiazole 1-oxide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3H-1,2-thiazole 1-oxide;hydrochloride?
The IUPAC name of 2-methyl-3H-1,2-thiazole 1-oxide;hydrochloride (CID 70074222) is 2-methyl-3H-1,2-thiazole 1-oxide;hydrochloride.
What is the SMILES notation for 2-methyl-3H-1,2-thiazole 1-oxide;hydrochloride?
The canonical SMILES for 2-methyl-3H-1,2-thiazole 1-oxide;hydrochloride is CN1CC=CS1=O.Cl.
What is the InChIKey of 2-methyl-3H-1,2-thiazole 1-oxide;hydrochloride?
The InChIKey is SADPNGVGIFQCOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NOS.ClH/c1-5-3-2-4-7(5)6;/h2,4H,3H2,1H3;1H.
What are the key properties of 2-methyl-3H-1,2-thiazole 1-oxide;hydrochloride?
2-methyl-3H-1,2-thiazole 1-oxide;hydrochloride has a molecular weight of 153.63 g/mol, XLogP of 0.53, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3H-1,2-thiazole 1-oxide;hydrochloride is sourced from PubChem (CID 70074222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).