C34H48N6O3S — CID 70074224
N-[(2S)-2-[[(1R,2S)-3-cyclohexyl-1-hydroxy-1-(1H-imidazol-2-yl)propan-2-yl]amino]-3-(1H-imidazol-5-yl)propanoyl]-4-cyclohexylsulfanyl-3-phenylbutanamide (PubChem CID 70074224) has the molecular formula C34H48N6O3S and a molecular weight of 620.86 g/mol. Its IUPAC name is N-[(2S)-2-[[(1R,2S)-3-cyclohexyl-1-hydroxy-1-(1H-imidazol-2-yl)propan-2-yl]amino]-3-(1H-imidazol-5-yl)propanoyl]-4-cyclohexylsulfanyl-3-phenylbutanamide.
| Compound Name | N-[(2S)-2-[[(1R,2S)-3-cyclohexyl-1-hydroxy-1-(1H-imidazol-2-yl)propan-2-yl]amino]-3-(1H-imidazol-5-yl)propanoyl]-4-cyclohexylsulfanyl-3-phenylbutanamide |
|---|---|
| PubChem CID | 70074224 |
| Molecular Formula | C34H48N6O3S |
| Molecular Weight | 620.86 g/mol |
| Exact Mass | 620.35 |
| IUPAC Name | N-[(2S)-2-[[(1R,2S)-3-cyclohexyl-1-hydroxy-1-(1H-imidazol-2-yl)propan-2-yl]amino]-3-(1H-imidazol-5-yl)propanoyl]-4-cyclohexylsulfanyl-3-phenylbutanamide |
| SMILES | O=C(CC(CSC1CCCCC1)c1ccccc1)NC(=O)[C@H](Cc1cnc[nH]1)N[C@@H](CC1CCCCC1)[C@@H](O)c1ncc[nH]1 |
| InChI | InChI=1S/C34H48N6O3S/c41-31(19-26(25-12-6-2-7-13-25)22-44-28-14-8-3-9-15-28)40-34(43)30(20-27-21-35-23-38-27)39-29(18-24-10-4-1-5-11-24)32(42)33-36-16-17-37-33/h2,6-7,12-13,16-17,21,23-24,26,28-30,32,39,42H,1,3-5,8-11,14-15,18-20,22H2,(H,35,38)(H,36,37)(H,40,41,43)/t26?,29-,30-,32+/m0/s1 |
| InChIKey | LSKLQIQMTPJYAO-ISSGVSFLSA-N |
| XLogP | 5.59 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.86 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |