C15H18NO4- — CID 7007434
6-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]hexanoate (PubChem CID 7007434) has the molecular formula C15H18NO4- and a molecular weight of 276.31 g/mol. Its IUPAC name is 6-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]hexanoate.
| Compound Name | 6-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]hexanoate |
|---|---|
| PubChem CID | 7007434 |
| Molecular Formula | C15H18NO4- |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 6-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]hexanoate |
| SMILES | O=C([O-])CCCCCN1C(=O)[C@H]2[C@H](C1=O)[C@@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C15H19NO4/c17-11(18)4-2-1-3-7-16-14(19)12-9-5-6-10(8-9)13(12)15(16)20/h5-6,9-10,12-13H,1-4,7-8H2,(H,17,18)/p-1/t9-,10-,12-,13-/m1/s1 |
| InChIKey | JAWZRFZAOPGTPT-FPQZTECRSA-M |
| XLogP | 0.10 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|