C33H40N4O8S — CID 70074602
tert-butyl (2S)-1-[(3S)-3-[[(2S)-4-amino-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]amino]-2-hydroxy-4-phenylbutanoyl]pyrrolidine-2-carboxylate (PubChem CID 70074602) has the molecular formula C33H40N4O8S and a molecular weight of 652.77 g/mol. Its IUPAC name is tert-butyl (2S)-1-[(3S)-3-[[(2S)-4-amino-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]amino]-2-hydroxy-4-phenylbutanoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[(3S)-3-[[(2S)-4-amino-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]amino]-2-hydroxy-4-phenylbutanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 70074602 |
| Molecular Formula | C33H40N4O8S |
| Molecular Weight | 652.77 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | tert-butyl (2S)-1-[(3S)-3-[[(2S)-4-amino-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]amino]-2-hydroxy-4-phenylbutanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCN1C(=O)C(O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(N)=O)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C33H40N4O8S/c1-33(2,3)45-32(42)27-14-9-17-37(27)31(41)29(39)25(18-21-10-5-4-6-11-21)35-30(40)26(20-28(34)38)36-46(43,44)24-16-15-22-12-7-8-13-23(22)19-24/h4-8,10-13,15-16,19,25-27,29,36,39H,9,14,17-18,20H2,1-3H3,(H2,34,38)(H,35,40)/t25-,26-,27-,29?/m0/s1 |
| InChIKey | ALPMQXZOQNCZMQ-FMDDCKEBSA-N |
| XLogP | 1.78 |
| TPSA | 185.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.77 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |