C25H33N3O7 — CID 70075147
methyl 5-[(7-ethoxy-7-oxoheptyl)carbamoyl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 70075147) has the molecular formula C25H33N3O7 and a molecular weight of 487.55 g/mol. Its IUPAC name is methyl 5-[(7-ethoxy-7-oxoheptyl)carbamoyl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | methyl 5-[(7-ethoxy-7-oxoheptyl)carbamoyl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 70075147 |
| Molecular Formula | C25H33N3O7 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | methyl 5-[(7-ethoxy-7-oxoheptyl)carbamoyl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)CCCCCCNC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H33N3O7/c1-5-35-20(29)13-8-6-7-9-14-26-24(30)21-16(2)27-17(3)22(25(31)34-4)23(21)18-11-10-12-19(15-18)28(32)33/h10-12,15,23,27H,5-9,13-14H2,1-4H3,(H,26,30) |
| InChIKey | PWUXZFNBHUKTSV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|