About azane;1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-methylcyclohexane-1-carbonitrile
azane;1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-methylcyclohexane-1-carbonitrile (PubChem CID 70075700) has the molecular formula C19H28N2O2
and a molecular weight of 316.44 g/mol. Its IUPAC name is azane;1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-methylcyclohexane-1-carbonitrile.
Molecular Properties
| Compound Name | azane;1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-methylcyclohexane-1-carbonitrile |
| PubChem CID | 70075700 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | azane;1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-methylcyclohexane-1-carbonitrile |
| SMILES | COc1ccc(C2(C#N)CCC(C)CC2)cc1OCC1CC1.N |
| InChI | InChI=1S/C19H25NO2.H3N/c1-14-7-9-19(13-20,10-8-14)16-5-6-17(21-2)18(11-16)22-12-15-3-4-15;/h5-6,11,14-15H,3-4,7-10,12H2,1-2H3;1H3 |
| InChIKey | FVPNYSRHUVXKSM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-methylcyclohexane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-methylcyclohexane-1-carbonitrile?
The IUPAC name of azane;1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-methylcyclohexane-1-carbonitrile (CID 70075700) is azane;1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-methylcyclohexane-1-carbonitrile.
What is the SMILES notation for azane;1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-methylcyclohexane-1-carbonitrile?
The canonical SMILES for azane;1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-methylcyclohexane-1-carbonitrile is COc1ccc(C2(C#N)CCC(C)CC2)cc1OCC1CC1.N.
What is the InChIKey of azane;1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-methylcyclohexane-1-carbonitrile?
The InChIKey is FVPNYSRHUVXKSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO2.H3N/c1-14-7-9-19(13-20,10-8-14)16-5-6-17(21-2)18(11-16)22-12-15-3-4-15;/h5-6,11,14-15H,3-4,7-10,12H2,1-2H3;1H3.
What are the key properties of azane;1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-methylcyclohexane-1-carbonitrile?
azane;1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-methylcyclohexane-1-carbonitrile has a molecular weight of 316.44 g/mol, XLogP of 4.62, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-methylcyclohexane-1-carbonitrile is sourced from PubChem (CID 70075700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).