C10H12N4O4 — CID 70077238
1,5,8,12-tetrazatricyclo[8.4.0.03,8]tetradecane-2,6,9,13-tetrone (PubChem CID 70077238) has the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. Its IUPAC name is 1,5,8,12-tetrazatricyclo[8.4.0.03,8]tetradecane-2,6,9,13-tetrone.
| Compound Name | 1,5,8,12-tetrazatricyclo[8.4.0.03,8]tetradecane-2,6,9,13-tetrone |
|---|---|
| PubChem CID | 70077238 |
| Molecular Formula | C10H12N4O4 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 1,5,8,12-tetrazatricyclo[8.4.0.03,8]tetradecane-2,6,9,13-tetrone |
| SMILES | O=C1CN2C(=O)C3CNC(=O)CN3C(=O)C2CN1 |
| InChI | InChI=1S/C10H12N4O4/c15-7-3-13-5(1-11-7)9(17)14-4-8(16)12-2-6(14)10(13)18/h5-6H,1-4H2,(H,11,15)(H,12,16) |
| InChIKey | DMZUOPOMCQLVRC-UHFFFAOYSA-N |
| XLogP | -3.35 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |