About 1,3-benzoxazin-2-one;hydrochloride
1,3-benzoxazin-2-one;hydrochloride (PubChem CID 70077294) has the molecular formula C8H6ClNO2
and a molecular weight of 183.59 g/mol. Its IUPAC name is 1,3-benzoxazin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1,3-benzoxazin-2-one;hydrochloride |
| PubChem CID | 70077294 |
| Molecular Formula | C8H6ClNO2 |
| Molecular Weight | 183.59 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | 1,3-benzoxazin-2-one;hydrochloride |
| SMILES | Cl.O=c1ncc2ccccc2o1 |
| InChI | InChI=1S/C8H5NO2.ClH/c10-8-9-5-6-3-1-2-4-7(6)11-8;/h1-5H;1H |
| InChIKey | CZLZPUDSGSGCSG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.59 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-benzoxazin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzoxazin-2-one;hydrochloride?
The IUPAC name of 1,3-benzoxazin-2-one;hydrochloride (CID 70077294) is 1,3-benzoxazin-2-one;hydrochloride.
What is the SMILES notation for 1,3-benzoxazin-2-one;hydrochloride?
The canonical SMILES for 1,3-benzoxazin-2-one;hydrochloride is Cl.O=c1ncc2ccccc2o1.
What is the InChIKey of 1,3-benzoxazin-2-one;hydrochloride?
The InChIKey is CZLZPUDSGSGCSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2.ClH/c10-8-9-5-6-3-1-2-4-7(6)11-8;/h1-5H;1H.
What are the key properties of 1,3-benzoxazin-2-one;hydrochloride?
1,3-benzoxazin-2-one;hydrochloride has a molecular weight of 183.59 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzoxazin-2-one;hydrochloride is sourced from PubChem (CID 70077294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).