C23H21Cl3N2O6S — CID 70077789
(2,4,6-trichlorophenyl) 4-[(2S)-2-[(3-acetyl-1,3-thiazolidine-4-carbonyl)amino]-3-methoxy-3-oxopropyl]benzoate (PubChem CID 70077789) has the molecular formula C23H21Cl3N2O6S and a molecular weight of 559.86 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 4-[(2S)-2-[(3-acetyl-1,3-thiazolidine-4-carbonyl)amino]-3-methoxy-3-oxopropyl]benzoate.
| Compound Name | (2,4,6-trichlorophenyl) 4-[(2S)-2-[(3-acetyl-1,3-thiazolidine-4-carbonyl)amino]-3-methoxy-3-oxopropyl]benzoate |
|---|---|
| PubChem CID | 70077789 |
| Molecular Formula | C23H21Cl3N2O6S |
| Molecular Weight | 559.86 g/mol |
| Exact Mass | 558.02 |
| IUPAC Name | (2,4,6-trichlorophenyl) 4-[(2S)-2-[(3-acetyl-1,3-thiazolidine-4-carbonyl)amino]-3-methoxy-3-oxopropyl]benzoate |
| SMILES | COC(=O)[C@H](Cc1ccc(C(=O)Oc2c(Cl)cc(Cl)cc2Cl)cc1)NC(=O)C1CSCN1C(C)=O |
| InChI | InChI=1S/C23H21Cl3N2O6S/c1-12(29)28-11-35-10-19(28)21(30)27-18(23(32)33-2)7-13-3-5-14(6-4-13)22(31)34-20-16(25)8-15(24)9-17(20)26/h3-6,8-9,18-19H,7,10-11H2,1-2H3,(H,27,30)/t18-,19?/m0/s1 |
| InChIKey | GZZOOIDYRBRXHY-OYKVQYDMSA-N |
| XLogP | 3.99 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.86 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|