C11H13NO — CID 70077879
1,2,3,3a,4,5a-hexahydrochromeno[3,4-c]pyrrole (PubChem CID 70077879) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 1,2,3,3a,4,5a-hexahydrochromeno[3,4-c]pyrrole.
| Compound Name | 1,2,3,3a,4,5a-hexahydrochromeno[3,4-c]pyrrole |
|---|---|
| PubChem CID | 70077879 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 1,2,3,3a,4,5a-hexahydrochromeno[3,4-c]pyrrole |
| SMILES | C1=CC2=C3CNCC3COC2C=C1 |
| InChI | InChI=1S/C11H13NO/c1-2-4-11-9(3-1)10-6-12-5-8(10)7-13-11/h1-4,8,11-12H,5-7H2 |
| InChIKey | HGMGCQIEKNUIAM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |