C27H33N3O3S — CID 70078365
ethyl 2-[7-[methyl-[4-(thiomorpholine-4-carboximidoyl)benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate (PubChem CID 70078365) has the molecular formula C27H33N3O3S and a molecular weight of 479.65 g/mol. Its IUPAC name is ethyl 2-[7-[methyl-[4-(thiomorpholine-4-carboximidoyl)benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate.
| Compound Name | ethyl 2-[7-[methyl-[4-(thiomorpholine-4-carboximidoyl)benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 70078365 |
| Molecular Formula | C27H33N3O3S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | ethyl 2-[7-[methyl-[4-(thiomorpholine-4-carboximidoyl)benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
| SMILES | [H]/N=C(/c1ccc(C(=O)N(C)c2ccc3c(c2)CC(CC(=O)OCC)CC3)cc1)N1CCSCC1 |
| InChI | InChI=1S/C27H33N3O3S/c1-3-33-25(31)17-19-4-5-20-10-11-24(18-23(20)16-19)29(2)27(32)22-8-6-21(7-9-22)26(28)30-12-14-34-15-13-30/h6-11,18-19,28H,3-5,12-17H2,1-2H3/b28-26- |
| InChIKey | VWXNBDZDGUKBQQ-SGEDCAFJSA-N |
| XLogP | 4.40 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|