About 2,3-dihydro-1H-indene;phenylmethanamine
2,3-dihydro-1H-indene;phenylmethanamine (PubChem CID 70078928) has the molecular formula C16H19N
and a molecular weight of 225.33 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene;phenylmethanamine.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-indene;phenylmethanamine |
| PubChem CID | 70078928 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 2,3-dihydro-1H-indene;phenylmethanamine |
| SMILES | NCc1ccccc1.c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C9H10.C7H9N/c1-2-5-9-7-3-6-8(9)4-1;8-6-7-4-2-1-3-5-7/h1-2,4-5H,3,6-7H2;1-5H,6,8H2 |
| InChIKey | RYFAGUVTUQGHHI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dihydro-1H-indene;phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-indene;phenylmethanamine?
The IUPAC name of 2,3-dihydro-1H-indene;phenylmethanamine (CID 70078928) is 2,3-dihydro-1H-indene;phenylmethanamine.
What is the SMILES notation for 2,3-dihydro-1H-indene;phenylmethanamine?
The canonical SMILES for 2,3-dihydro-1H-indene;phenylmethanamine is NCc1ccccc1.c1ccc2c(c1)CCC2.
What is the InChIKey of 2,3-dihydro-1H-indene;phenylmethanamine?
The InChIKey is RYFAGUVTUQGHHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C7H9N/c1-2-5-9-7-3-6-8(9)4-1;8-6-7-4-2-1-3-5-7/h1-2,4-5H,3,6-7H2;1-5H,6,8H2.
What are the key properties of 2,3-dihydro-1H-indene;phenylmethanamine?
2,3-dihydro-1H-indene;phenylmethanamine has a molecular weight of 225.33 g/mol, XLogP of 3.32, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-indene;phenylmethanamine is sourced from PubChem (CID 70078928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).