C15H11N3O3 — CID 70079353
4-ethoxy-2,6-bis(furan-2-yl)pyrimidine-5-carbonitrile (PubChem CID 70079353) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 4-ethoxy-2,6-bis(furan-2-yl)pyrimidine-5-carbonitrile.
| Compound Name | 4-ethoxy-2,6-bis(furan-2-yl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 70079353 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-ethoxy-2,6-bis(furan-2-yl)pyrimidine-5-carbonitrile |
| SMILES | CCOc1nc(-c2ccco2)nc(-c2ccco2)c1C#N |
| InChI | InChI=1S/C15H11N3O3/c1-2-19-15-10(9-16)13(11-5-3-7-20-11)17-14(18-15)12-6-4-8-21-12/h3-8H,2H2,1H3 |
| InChIKey | BHCQVPQFYMZCRY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |