C15H11N3S — CID 700795
5,6-diphenyl-2H-1,2,4-triazine-3-thione (PubChem CID 700795) has the molecular formula C15H11N3S and a molecular weight of 265.34 g/mol. Its IUPAC name is 5,6-diphenyl-2H-1,2,4-triazine-3-thione.
| Compound Name | 5,6-diphenyl-2H-1,2,4-triazine-3-thione |
|---|---|
| PubChem CID | 700795 |
| Molecular Formula | C15H11N3S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 5,6-diphenyl-2H-1,2,4-triazine-3-thione |
| SMILES | S=c1nc(-c2ccccc2)c(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C15H11N3S/c19-15-16-13(11-7-3-1-4-8-11)14(17-18-15)12-9-5-2-6-10-12/h1-10H,(H,16,18,19) |
| InChIKey | PESHFZNRQCTMDJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|