About 7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indole
7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indole (PubChem CID 700805) has the molecular formula C11H10BrN
and a molecular weight of 236.11 g/mol. Its IUPAC name is 7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indole.
Molecular Properties
| Compound Name | 7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indole |
| PubChem CID | 700805 |
| Molecular Formula | C11H10BrN |
| Molecular Weight | 236.11 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indole |
| SMILES | Brc1ccc2[nH]c3c(c2c1)CCC3 |
| InChI | InChI=1S/C11H10BrN/c12-7-4-5-11-9(6-7)8-2-1-3-10(8)13-11/h4-6,13H,1-3H2 |
| InChIKey | XKDWSCYYHKJAGK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.11 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indole?
The IUPAC name of 7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indole (CID 700805) is 7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indole.
What is the SMILES notation for 7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indole?
The canonical SMILES for 7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indole is Brc1ccc2[nH]c3c(c2c1)CCC3.
What is the InChIKey of 7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indole?
The InChIKey is XKDWSCYYHKJAGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrN/c12-7-4-5-11-9(6-7)8-2-1-3-10(8)13-11/h4-6,13H,1-3H2.
What are the key properties of 7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indole?
7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indole has a molecular weight of 236.11 g/mol, XLogP of 3.42, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1,2,3,4-tetrahydrocyclopenta[b]indole is sourced from PubChem (CID 700805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).