About 1-cyclopropyl-2-[3-(3,4-dichlorophenyl)prop-2-enyl]-2-methylpiperidine
1-cyclopropyl-2-[3-(3,4-dichlorophenyl)prop-2-enyl]-2-methylpiperidine (PubChem CID 70080876) has the molecular formula C18H23Cl2N
and a molecular weight of 324.30 g/mol. Its IUPAC name is 1-cyclopropyl-2-[3-(3,4-dichlorophenyl)prop-2-enyl]-2-methylpiperidine.
Molecular Properties
| Compound Name | 1-cyclopropyl-2-[3-(3,4-dichlorophenyl)prop-2-enyl]-2-methylpiperidine |
| PubChem CID | 70080876 |
| Molecular Formula | C18H23Cl2N |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 1-cyclopropyl-2-[3-(3,4-dichlorophenyl)prop-2-enyl]-2-methylpiperidine |
| SMILES | CC1(CC=Cc2ccc(Cl)c(Cl)c2)CCCCN1C1CC1 |
| InChI | InChI=1S/C18H23Cl2N/c1-18(10-2-3-12-21(18)15-7-8-15)11-4-5-14-6-9-16(19)17(20)13-14/h4-6,9,13,15H,2-3,7-8,10-12H2,1H3 |
| InChIKey | PRDXBYFRDFRXFV-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopropyl-2-[3-(3,4-dichlorophenyl)prop-2-enyl]-2-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2-[3-(3,4-dichlorophenyl)prop-2-enyl]-2-methylpiperidine?
The IUPAC name of 1-cyclopropyl-2-[3-(3,4-dichlorophenyl)prop-2-enyl]-2-methylpiperidine (CID 70080876) is 1-cyclopropyl-2-[3-(3,4-dichlorophenyl)prop-2-enyl]-2-methylpiperidine.
What is the SMILES notation for 1-cyclopropyl-2-[3-(3,4-dichlorophenyl)prop-2-enyl]-2-methylpiperidine?
The canonical SMILES for 1-cyclopropyl-2-[3-(3,4-dichlorophenyl)prop-2-enyl]-2-methylpiperidine is CC1(CC=Cc2ccc(Cl)c(Cl)c2)CCCCN1C1CC1.
What is the InChIKey of 1-cyclopropyl-2-[3-(3,4-dichlorophenyl)prop-2-enyl]-2-methylpiperidine?
The InChIKey is PRDXBYFRDFRXFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23Cl2N/c1-18(10-2-3-12-21(18)15-7-8-15)11-4-5-14-6-9-16(19)17(20)13-14/h4-6,9,13,15H,2-3,7-8,10-12H2,1H3.
What are the key properties of 1-cyclopropyl-2-[3-(3,4-dichlorophenyl)prop-2-enyl]-2-methylpiperidine?
1-cyclopropyl-2-[3-(3,4-dichlorophenyl)prop-2-enyl]-2-methylpiperidine has a molecular weight of 324.30 g/mol, XLogP of 5.80, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2-[3-(3,4-dichlorophenyl)prop-2-enyl]-2-methylpiperidine is sourced from PubChem (CID 70080876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).