C27H31NO2 — CID 70081140
(3S)-3-[2-(dibenzylamino)phenyl]-4,4-dimethylpentanoic acid (PubChem CID 70081140) has the molecular formula C27H31NO2 and a molecular weight of 401.55 g/mol. Its IUPAC name is (3S)-3-[2-(dibenzylamino)phenyl]-4,4-dimethylpentanoic acid.
| Compound Name | (3S)-3-[2-(dibenzylamino)phenyl]-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 70081140 |
| Molecular Formula | C27H31NO2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (3S)-3-[2-(dibenzylamino)phenyl]-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)[C@H](CC(=O)O)c1ccccc1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H31NO2/c1-27(2,3)24(18-26(29)30)23-16-10-11-17-25(23)28(19-21-12-6-4-7-13-21)20-22-14-8-5-9-15-22/h4-17,24H,18-20H2,1-3H3,(H,29,30)/t24-/m1/s1 |
| InChIKey | YIKAZKZTUMURMV-XMMPIXPASA-N |
| XLogP | 6.50 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |