C28H31N7O6S — CID 70081274
N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)-2-[2-[2-(5-methyltetrazol-2-yl)ethyl]-4-(1,3-oxazol-2-yl)phenyl]benzenesulfonamide (PubChem CID 70081274) has the molecular formula C28H31N7O6S and a molecular weight of 593.67 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)-2-[2-[2-(5-methyltetrazol-2-yl)ethyl]-4-(1,3-oxazol-2-yl)phenyl]benzenesulfonamide.
| Compound Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)-2-[2-[2-(5-methyltetrazol-2-yl)ethyl]-4-(1,3-oxazol-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70081274 |
| Molecular Formula | C28H31N7O6S |
| Molecular Weight | 593.67 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)-2-[2-[2-(5-methyltetrazol-2-yl)ethyl]-4-(1,3-oxazol-2-yl)phenyl]benzenesulfonamide |
| SMILES | COCCOCN(c1onc(C)c1C)S(=O)(=O)c1ccccc1-c1ccc(-c2ncco2)cc1CCn1nnc(C)n1 |
| InChI | InChI=1S/C28H31N7O6S/c1-19-20(2)32-41-28(19)34(18-39-16-15-38-4)42(36,37)26-8-6-5-7-25(26)24-10-9-23(27-29-12-14-40-27)17-22(24)11-13-35-31-21(3)30-33-35/h5-10,12,14,17H,11,13,15-16,18H2,1-4H3 |
| InChIKey | OVZJQJFWUGJNIX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 151.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.67 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|