About (2S)-2-amino-4-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]butanoic acid
(2S)-2-amino-4-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]butanoic acid (PubChem CID 70081480) has the molecular formula C13H13FN2O4
and a molecular weight of 280.25 g/mol. Its IUPAC name is (2S)-2-amino-4-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]butanoic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-4-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]butanoic acid |
| PubChem CID | 70081480 |
| Molecular Formula | C13H13FN2O4 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (2S)-2-amino-4-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]butanoic acid |
| SMILES | N[C@@H](CCc1c(-c2ccc(F)cc2)o[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C13H13FN2O4/c14-8-3-1-7(2-4-8)11-9(12(17)16-20-11)5-6-10(15)13(18)19/h1-4,10H,5-6,15H2,(H,16,17)(H,18,19)/t10-/m0/s1 |
| InChIKey | HGBOOTHJJZMTMD-JTQLQIEISA-N |
| XLogP | 1.12 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-amino-4-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-4-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]butanoic acid?
The IUPAC name of (2S)-2-amino-4-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]butanoic acid (CID 70081480) is (2S)-2-amino-4-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]butanoic acid.
What is the SMILES notation for (2S)-2-amino-4-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]butanoic acid?
The canonical SMILES for (2S)-2-amino-4-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]butanoic acid is N[C@@H](CCc1c(-c2ccc(F)cc2)o[nH]c1=O)C(=O)O.
What is the InChIKey of (2S)-2-amino-4-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]butanoic acid?
The InChIKey is HGBOOTHJJZMTMD-JTQLQIEISA-N. The full InChI is InChI=1S/C13H13FN2O4/c14-8-3-1-7(2-4-8)11-9(12(17)16-20-11)5-6-10(15)13(18)19/h1-4,10H,5-6,15H2,(H,16,17)(H,18,19)/t10-/m0/s1.
What are the key properties of (2S)-2-amino-4-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]butanoic acid?
(2S)-2-amino-4-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]butanoic acid has a molecular weight of 280.25 g/mol, XLogP of 1.12, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-4-[5-(4-fluorophenyl)-3-oxo-1,2-oxazol-4-yl]butanoic acid is sourced from PubChem (CID 70081480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).