C17H23NO5 — CID 70081633
2-[(2-methoxybenzoyl)amino]butanoic acid;5-oxabicyclo[2.1.1]hexane (PubChem CID 70081633) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-[(2-methoxybenzoyl)amino]butanoic acid;5-oxabicyclo[2.1.1]hexane.
| Compound Name | 2-[(2-methoxybenzoyl)amino]butanoic acid;5-oxabicyclo[2.1.1]hexane |
|---|---|
| PubChem CID | 70081633 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-[(2-methoxybenzoyl)amino]butanoic acid;5-oxabicyclo[2.1.1]hexane |
| SMILES | C1CC2CC1O2.CCC(NC(=O)c1ccccc1OC)C(=O)O |
| InChI | InChI=1S/C12H15NO4.C5H8O/c1-3-9(12(15)16)13-11(14)8-6-4-5-7-10(8)17-2;1-2-5-3-4(1)6-5/h4-7,9H,3H2,1-2H3,(H,13,14)(H,15,16);4-5H,1-3H2 |
| InChIKey | YCKUNPUSJUYKJX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |