C19H21N3O2 — CID 70081843
7,8-dimethoxy-N,N-dimethyl-1-phenyl-5H-2,3-benzodiazepin-4-amine (PubChem CID 70081843) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 7,8-dimethoxy-N,N-dimethyl-1-phenyl-5H-2,3-benzodiazepin-4-amine.
| Compound Name | 7,8-dimethoxy-N,N-dimethyl-1-phenyl-5H-2,3-benzodiazepin-4-amine |
|---|---|
| PubChem CID | 70081843 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 7,8-dimethoxy-N,N-dimethyl-1-phenyl-5H-2,3-benzodiazepin-4-amine |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1)=NN=C(N(C)C)C2 |
| InChI | InChI=1S/C19H21N3O2/c1-22(2)18-11-14-10-16(23-3)17(24-4)12-15(14)19(21-20-18)13-8-6-5-7-9-13/h5-10,12H,11H2,1-4H3 |
| InChIKey | VFXMEMJGGMYZSK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |