C33H40N4O7 — CID 70081960
methyl 2-[(4R)-2-[(4-aminophenyl)methyl]-8-[3-[butoxycarbonyl-(1-oxidopyridin-1-ium-2-yl)amino]propoxy]-3-oxo-4,5-dihydro-1H-2-benzazepin-4-yl]acetate (PubChem CID 70081960) has the molecular formula C33H40N4O7 and a molecular weight of 604.70 g/mol. Its IUPAC name is methyl 2-[(4R)-2-[(4-aminophenyl)methyl]-8-[3-[butoxycarbonyl-(1-oxidopyridin-1-ium-2-yl)amino]propoxy]-3-oxo-4,5-dihydro-1H-2-benzazepin-4-yl]acetate.
| Compound Name | methyl 2-[(4R)-2-[(4-aminophenyl)methyl]-8-[3-[butoxycarbonyl-(1-oxidopyridin-1-ium-2-yl)amino]propoxy]-3-oxo-4,5-dihydro-1H-2-benzazepin-4-yl]acetate |
|---|---|
| PubChem CID | 70081960 |
| Molecular Formula | C33H40N4O7 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | methyl 2-[(4R)-2-[(4-aminophenyl)methyl]-8-[3-[butoxycarbonyl-(1-oxidopyridin-1-ium-2-yl)amino]propoxy]-3-oxo-4,5-dihydro-1H-2-benzazepin-4-yl]acetate |
| SMILES | CCCCOC(=O)N(CCCOc1ccc2c(c1)CN(Cc1ccc(N)cc1)C(=O)[C@@H](CC(=O)OC)C2)c1cccc[n+]1[O-] |
| InChI | InChI=1S/C33H40N4O7/c1-3-4-17-44-33(40)36(30-8-5-6-16-37(30)41)15-7-18-43-29-14-11-25-19-26(21-31(38)42-2)32(39)35(23-27(25)20-29)22-24-9-12-28(34)13-10-24/h5-6,8-14,16,20,26H,3-4,7,15,17-19,21-23,34H2,1-2H3/t26-/m1/s1 |
| InChIKey | IEAWMNPZNJPXIK-AREMUKBSSA-N |
| XLogP | 4.38 |
| TPSA | 138.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|