C22H23FN4O2S — CID 70082133
N'-[3-[2-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-1-oxo-1,4-thiazinane-4-carboximidamide (PubChem CID 70082133) has the molecular formula C22H23FN4O2S and a molecular weight of 426.52 g/mol. Its IUPAC name is N'-[3-[2-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-1-oxo-1,4-thiazinane-4-carboximidamide.
| Compound Name | N'-[3-[2-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-1-oxo-1,4-thiazinane-4-carboximidamide |
|---|---|
| PubChem CID | 70082133 |
| Molecular Formula | C22H23FN4O2S |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N'-[3-[2-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-1-oxo-1,4-thiazinane-4-carboximidamide |
| SMILES | NC(=Nc1cc(CCc2ccc(-c3ccccc3)c(F)c2)no1)N1CCS(=O)CC1 |
| InChI | InChI=1S/C22H23FN4O2S/c23-20-14-16(7-9-19(20)17-4-2-1-3-5-17)6-8-18-15-21(29-26-18)25-22(24)27-10-12-30(28)13-11-27/h1-5,7,9,14-15H,6,8,10-13H2,(H2,24,25) |
| InChIKey | SVMIRJDNIAMZQP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|