C28H38N4OS — CID 70082228
3-[4-[6-[(2R,6S)-2,6-dimethylpiperidin-2-yl]hexyl]-3-oxo-1,4-benzothiazin-2-yl]benzenecarboximidamide (PubChem CID 70082228) has the molecular formula C28H38N4OS and a molecular weight of 478.71 g/mol. Its IUPAC name is 3-[4-[6-[(2R,6S)-2,6-dimethylpiperidin-2-yl]hexyl]-3-oxo-1,4-benzothiazin-2-yl]benzenecarboximidamide.
| Compound Name | 3-[4-[6-[(2R,6S)-2,6-dimethylpiperidin-2-yl]hexyl]-3-oxo-1,4-benzothiazin-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 70082228 |
| Molecular Formula | C28H38N4OS |
| Molecular Weight | 478.71 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | 3-[4-[6-[(2R,6S)-2,6-dimethylpiperidin-2-yl]hexyl]-3-oxo-1,4-benzothiazin-2-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(C2Sc3ccccc3N(CCCCCC[C@]3(C)CCC[C@H](C)N3)C2=O)c1 |
| InChI | InChI=1S/C28H38N4OS/c1-20-11-10-17-28(2,31-20)16-7-3-4-8-18-32-23-14-5-6-15-24(23)34-25(27(32)33)21-12-9-13-22(19-21)26(29)30/h5-6,9,12-15,19-20,25,31H,3-4,7-8,10-11,16-18H2,1-2H3,(H3,29,30)/t20-,25?,28+/m0/s1 |
| InChIKey | DBEBCOUOLOQYFJ-BZSWLZEGSA-N |
| XLogP | 6.02 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.71 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|