C22H23FN4O3 — CID 70082548
2-[[N'-[[3-[2-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]methyl]carbamimidoyl]amino]propanoic acid (PubChem CID 70082548) has the molecular formula C22H23FN4O3 and a molecular weight of 410.45 g/mol. Its IUPAC name is 2-[[N'-[[3-[2-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]methyl]carbamimidoyl]amino]propanoic acid.
| Compound Name | 2-[[N'-[[3-[2-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]methyl]carbamimidoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70082548 |
| Molecular Formula | C22H23FN4O3 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-[[N'-[[3-[2-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]methyl]carbamimidoyl]amino]propanoic acid |
| SMILES | CC(N/C(N)=N/Cc1cc(CCc2ccc(-c3ccccc3)c(F)c2)no1)C(=O)O |
| InChI | InChI=1S/C22H23FN4O3/c1-14(21(28)29)26-22(24)25-13-18-12-17(27-30-18)9-7-15-8-10-19(20(23)11-15)16-5-3-2-4-6-16/h2-6,8,10-12,14H,7,9,13H2,1H3,(H,28,29)(H3,24,25,26) |
| InChIKey | KGTJSIQOTVQBDE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|