C27H38N2 — CID 70082751
[(3R,4S)-1-pentyl-4-phenylpiperidin-3-yl]-(5,6,7,8-tetrahydronaphthalen-1-yl)methanamine (PubChem CID 70082751) has the molecular formula C27H38N2 and a molecular weight of 390.62 g/mol. Its IUPAC name is [(3R,4S)-1-pentyl-4-phenylpiperidin-3-yl]-(5,6,7,8-tetrahydronaphthalen-1-yl)methanamine.
| Compound Name | [(3R,4S)-1-pentyl-4-phenylpiperidin-3-yl]-(5,6,7,8-tetrahydronaphthalen-1-yl)methanamine |
|---|---|
| PubChem CID | 70082751 |
| Molecular Formula | C27H38N2 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | [(3R,4S)-1-pentyl-4-phenylpiperidin-3-yl]-(5,6,7,8-tetrahydronaphthalen-1-yl)methanamine |
| SMILES | CCCCCN1CC[C@H](c2ccccc2)[C@@H](C(N)c2cccc3c2CCCC3)C1 |
| InChI | InChI=1S/C27H38N2/c1-2-3-9-18-29-19-17-24(21-11-5-4-6-12-21)26(20-29)27(28)25-16-10-14-22-13-7-8-15-23(22)25/h4-6,10-12,14,16,24,26-27H,2-3,7-9,13,15,17-20,28H2,1H3/t24-,26+,27?/m1/s1 |
| InChIKey | PYQFRRXVEYTUFW-MFHGLKJTSA-N |
| XLogP | 5.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|