About (1Z,5Z)-pyrido[1,2-a][1,5]diazocin-8-one
(1Z,5Z)-pyrido[1,2-a][1,5]diazocin-8-one (PubChem CID 70082870) has the molecular formula C10H8N2O
and a molecular weight of 172.19 g/mol. Its IUPAC name is (1Z,5Z)-pyrido[1,2-a][1,5]diazocin-8-one.
Molecular Properties
| Compound Name | (1Z,5Z)-pyrido[1,2-a][1,5]diazocin-8-one |
| PubChem CID | 70082870 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | (1Z,5Z)-pyrido[1,2-a][1,5]diazocin-8-one |
| SMILES | O=c1cccc2n1/C=C\C=N/C=C\2 |
| InChI | InChI=1S/C10H8N2O/c13-10-4-1-3-9-5-7-11-6-2-8-12(9)10/h1-8H/b7-5-,8-2-,11-6- |
| InChIKey | YYFWZOCPJXTWIJ-ULLHFRDYSA-N |
| XLogP | 1.37 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1Z,5Z)-pyrido[1,2-a][1,5]diazocin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,5Z)-pyrido[1,2-a][1,5]diazocin-8-one?
The IUPAC name of (1Z,5Z)-pyrido[1,2-a][1,5]diazocin-8-one (CID 70082870) is (1Z,5Z)-pyrido[1,2-a][1,5]diazocin-8-one.
What is the SMILES notation for (1Z,5Z)-pyrido[1,2-a][1,5]diazocin-8-one?
The canonical SMILES for (1Z,5Z)-pyrido[1,2-a][1,5]diazocin-8-one is O=c1cccc2n1/C=C\C=N/C=C\2.
What is the InChIKey of (1Z,5Z)-pyrido[1,2-a][1,5]diazocin-8-one?
The InChIKey is YYFWZOCPJXTWIJ-ULLHFRDYSA-N. The full InChI is InChI=1S/C10H8N2O/c13-10-4-1-3-9-5-7-11-6-2-8-12(9)10/h1-8H/b7-5-,8-2-,11-6-.
What are the key properties of (1Z,5Z)-pyrido[1,2-a][1,5]diazocin-8-one?
(1Z,5Z)-pyrido[1,2-a][1,5]diazocin-8-one has a molecular weight of 172.19 g/mol, XLogP of 1.37, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,5Z)-pyrido[1,2-a][1,5]diazocin-8-one is sourced from PubChem (CID 70082870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).