C13H22N4O3 — CID 70083043
methyl (3R,3aR,6aS)-3-(5-amino-5-iminopentyl)-2-oxo-3,3a,4,5,6,6a-hexahydropyrrolo[3,4-b]pyrrole-1-carboxylate (PubChem CID 70083043) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl (3R,3aR,6aS)-3-(5-amino-5-iminopentyl)-2-oxo-3,3a,4,5,6,6a-hexahydropyrrolo[3,4-b]pyrrole-1-carboxylate.
| Compound Name | methyl (3R,3aR,6aS)-3-(5-amino-5-iminopentyl)-2-oxo-3,3a,4,5,6,6a-hexahydropyrrolo[3,4-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 70083043 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | methyl (3R,3aR,6aS)-3-(5-amino-5-iminopentyl)-2-oxo-3,3a,4,5,6,6a-hexahydropyrrolo[3,4-b]pyrrole-1-carboxylate |
| SMILES | [H]/N=C(\N)CCCC[C@H]1C(=O)N(C(=O)OC)[C@@H]2CNC[C@H]21 |
| InChI | InChI=1S/C13H22N4O3/c1-20-13(19)17-10-7-16-6-9(10)8(12(17)18)4-2-3-5-11(14)15/h8-10,16H,2-7H2,1H3,(H3,14,15)/t8-,9+,10-/m1/s1 |
| InChIKey | SVOQOVPGBOJRGJ-KXUCPTDWSA-N |
| XLogP | 0.30 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|