C25H39N5OS — CID 70083275
3-[4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzothiazin-2-yl]pyrrolidine-1-carboximidamide (PubChem CID 70083275) has the molecular formula C25H39N5OS and a molecular weight of 457.69 g/mol. Its IUPAC name is 3-[4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzothiazin-2-yl]pyrrolidine-1-carboximidamide.
| Compound Name | 3-[4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzothiazin-2-yl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 70083275 |
| Molecular Formula | C25H39N5OS |
| Molecular Weight | 457.69 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | 3-[4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzothiazin-2-yl]pyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCC(C2Sc3ccccc3N(CCCCC[C@]3(C)CCC[C@H](C)N3)C2=O)C1 |
| InChI | InChI=1S/C25H39N5OS/c1-18-9-8-14-25(2,28-18)13-6-3-7-15-30-20-10-4-5-11-21(20)32-22(23(30)31)19-12-16-29(17-19)24(26)27/h4-5,10-11,18-19,22,28H,3,6-9,12-17H2,1-2H3,(H3,26,27)/t18-,19?,22?,25+/m0/s1 |
| InChIKey | GVVJDMLIDDWOTI-PJBCDTOXSA-N |
| XLogP | 4.19 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.69 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|