C26H36N4OS2 — CID 70083298
5-[[4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzothiazin-2-yl]methyl]thiophene-2-carboximidamide (PubChem CID 70083298) has the molecular formula C26H36N4OS2 and a molecular weight of 484.74 g/mol. Its IUPAC name is 5-[[4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzothiazin-2-yl]methyl]thiophene-2-carboximidamide.
| Compound Name | 5-[[4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzothiazin-2-yl]methyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 70083298 |
| Molecular Formula | C26H36N4OS2 |
| Molecular Weight | 484.74 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 5-[[4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzothiazin-2-yl]methyl]thiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CC2Sc3ccccc3N(CCCCC[C@]3(C)CCC[C@H](C)N3)C2=O)s1 |
| InChI | InChI=1S/C26H36N4OS2/c1-18-9-8-15-26(2,29-18)14-6-3-7-16-30-20-10-4-5-11-21(20)33-23(25(30)31)17-19-12-13-22(32-19)24(27)28/h4-5,10-13,18,23,29H,3,6-9,14-17H2,1-2H3,(H3,27,28)/t18-,23?,26+/m0/s1 |
| InChIKey | NZSULQRBJBUSKP-BTCHQWDBSA-N |
| XLogP | 5.56 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.74 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|