C11H16N2O — CID 70083408
2-(2-aminoethyl)-2,3,4,6-tetrahydroquinolizin-1-one (PubChem CID 70083408) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-(2-aminoethyl)-2,3,4,6-tetrahydroquinolizin-1-one.
| Compound Name | 2-(2-aminoethyl)-2,3,4,6-tetrahydroquinolizin-1-one |
|---|---|
| PubChem CID | 70083408 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-(2-aminoethyl)-2,3,4,6-tetrahydroquinolizin-1-one |
| SMILES | NCCC1CCN2CC=CC=C2C1=O |
| InChI | InChI=1S/C11H16N2O/c12-6-4-9-5-8-13-7-2-1-3-10(13)11(9)14/h1-3,9H,4-8,12H2 |
| InChIKey | XTSYDKMLAHBAKF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |